Introduction：Basic information about CAS 266362-89-4|2-chloro-6-(4-chlorophenoxy)pyridine-4-carbothioamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-6-(4-chlorophenoxy)pyridine-4-carbothioamide |
|---|
| CAS Number | 266362-89-4 | Molecular Weight | 299.17600 |
|---|
| Density | 1.468g/cm3 | Boiling Point | 460.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl2N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.3ºC |
|---|
Names
| Name | 2-chloro-6-(4-chlorophenoxy)pyridine-4-carbothioamide |
|---|
Chemical & Physical Properties
| Density | 1.468g/cm3 |
|---|
| Boiling Point | 460.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl2N2OS |
|---|
| Molecular Weight | 299.17600 |
|---|
| Flash Point | 232.3ºC |
|---|
| Exact Mass | 297.97300 |
|---|
| PSA | 84.77000 |
|---|
| LogP | 4.53560 |
|---|
| Vapour Pressure | 1.16E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | TVDUOHYIGHFRDK-UHFFFAOYSA-N |
|---|
| SMILES | NC(=S)c1cc(Cl)nc(Oc2ccc(Cl)cc2)c1 |
|---|
