Introduction：Basic information about CAS 301134-94-1|2-[4-(2-Methoxyphenyl)piperidino]-5-nitrobenzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(2-Methoxyphenyl)piperidino]-5-nitrobenzaldehyde |
|---|
| CAS Number | 301134-94-1 | Molecular Weight | 340.37300 |
|---|
| Density | 1.244g/cm3 | Boiling Point | 524.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.2ºC |
|---|
Names
| Name | 2-[4-(2-methoxyphenyl)piperidin-1-yl]-5-nitrobenzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.244g/cm3 |
|---|
| Boiling Point | 524.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4 |
|---|
| Molecular Weight | 340.37300 |
|---|
| Flash Point | 271.2ºC |
|---|
| Exact Mass | 340.14200 |
|---|
| PSA | 75.36000 |
|---|
| LogP | 4.38810 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | TXTKGNOXCFAQCD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1C1CCN(c2ccc([N+](=O)[O-])cc2C=O)CC1 |
|---|
