Introduction：Basic information about CAS 680215-64-9|2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid |
|---|
| CAS Number | 680215-64-9 | Molecular Weight | 287.06300 |
|---|
| Density | 1.506g/cm3 | Boiling Point | 328.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7Cl2F3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.3ºC |
|---|
Names
| Name | 2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.506g/cm3 |
|---|
| Boiling Point | 328.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7Cl2F3O2 |
|---|
| Molecular Weight | 287.06300 |
|---|
| Flash Point | 152.3ºC |
|---|
| Exact Mass | 285.97800 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.59330 |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | VHOLGURUOOMPRW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(Cl)Cc1ccc(C(F)(F)F)cc1Cl |
|---|
