Introduction：Basic information about CAS 214124-83-1|1-(4-Nitrophenyl)-[1,4]diazepane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Nitrophenyl)-[1,4]diazepane |
|---|
| CAS Number | 214124-83-1 | Molecular Weight | 221.25600 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 403.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H15N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.8ºC |
|---|
Names
| Name | 1-(4-Nitrophenyl)-1,4-diazepane |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 403.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H15N3O2 |
|---|
| Molecular Weight | 221.25600 |
|---|
| Flash Point | 197.8ºC |
|---|
| Exact Mass | 221.11600 |
|---|
| PSA | 61.09000 |
|---|
| LogP | 2.31150 |
|---|
| Vapour Pressure | 1.02E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | LIQIZDGKPDHEPC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(N2CCCNCC2)cc1 |
|---|
