Introduction：Basic information about CAS 42533-63-1|1-(Bromomethyl)-2-chloro-4-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Bromomethyl)-2-chloro-4-nitrobenzene |
|---|
| CAS Number | 42533-63-1 | Molecular Weight | 250.47700 |
|---|
| Density | 1.755g/cm3 | Boiling Point | 322.8ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5BrClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 149ºC |
|---|
Names
| Name | 1-(Bromomethyl)-2-chloro-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.755g/cm3 |
|---|
| Boiling Point | 322.8ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5BrClNO2 |
|---|
| Molecular Weight | 250.47700 |
|---|
| Flash Point | 149ºC |
|---|
| Exact Mass | 248.91900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.66630 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | MBLOVZIAFQVXIN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(CBr)c(Cl)c1 |
|---|
Synonyms
| 2-chloro-4-nitrobenzyl bromide |
| 2-Chlor-4-nitro-benzylbromid |
| EINECS 255-874-8 |
| 4-bromomethyl-3-chloro nitrobenzene |
