Introduction:Basic information about CAS 2091-51-2|4-(bromomethyl)-2,6-ditert-butyl-phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(bromomethyl)-2,6-ditert-butyl-phenol |
|---|
| CAS Number | 2091-51-2 | Molecular Weight | 299.24700 |
|---|
| Density | 1.193g/cm3 | Boiling Point | 308.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H23BrO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140.6ºC |
|---|
Names
| Name | 4-(bromomethyl)-2,6-ditert-butylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.193g/cm3 |
|---|
| Boiling Point | 308.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H23BrO |
|---|
| Molecular Weight | 299.24700 |
|---|
| Flash Point | 140.6ºC |
|---|
| Exact Mass | 298.09300 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.88210 |
|---|
| Vapour Pressure | 0.000365mmHg at 25°C |
|---|
| Index of Refraction | 1.53 |
|---|
| InChIKey | YEOQCOZNFXPHHY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(CBr)cc(C(C)(C)C)c1O |
|---|
Safety Information
Customs
| HS Code | 2908199090 |
|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|---|
Synonyms
| Phenol,4-(bromomethyl)-2,6-bis(1,1-dimethylethyl) |
| 4-bromomethyl-2,6-di-tert-butylphenol |
| 3,5-di(tert-butyl)-4-hydroxybenzyl bromide |
| 2,6-di-t-butyl-4-bromomethylphenol |
| 2,6-bis-(1,1-dimethylethyl)-4-bromomethylphenol |
| 4-(Bromomethyl)-2,6-bis(1,1-dimethylethyl)phenol |