Introduction：Basic information about CAS 351003-19-5|3-(6-METHYL-2H-1 4-BENZOXAZIN-3(4H)-ONE&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(6-METHYL-2H-1 4-BENZOXAZIN-3(4H)-ONE& |
|---|
| CAS Number | 351003-19-5 | Molecular Weight | 216.23600 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 515.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H12N2O2 | Melting Point | 128-132ºC(lit.) |
|---|
| MSDS | / | Flash Point | 265.4ºC |
|---|
Names
| Name | 3-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)propanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 515.2ºC at 760mmHg |
|---|
| Melting Point | 128-132ºC(lit.) |
|---|
| Molecular Formula | C12H12N2O2 |
|---|
| Molecular Weight | 216.23600 |
|---|
| Flash Point | 265.4ºC |
|---|
| Exact Mass | 216.09000 |
|---|
| PSA | 53.33000 |
|---|
| LogP | 1.69908 |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | SZEGFLHUNYLAOJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2c(c1)N(CCC#N)C(=O)CO2 |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
Synonyms
| MFCD03427105 |
| 3-(6-Methyl-2H-1,4-benzoxazin-3(4H)-one-4-yl)-propionitrile |
| 4H-1,4-Benzoxazine-4-propanenitrile,2,3-dihydro-6-methyl-3-oxo |
| 3-(6-METHYL-2H-1 4-BENZOXAZIN-3(4H)-ONE |
