Introduction：Basic information about CAS 128018-44-0|(2S,3S)-1,2-Epoxy-3-(Cbz-amino)-4-phenylbutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2S,3S)-1,2-Epoxy-3-(Cbz-amino)-4-phenylbutane |
|---|
| CAS Number | 128018-44-0 | Molecular Weight | 297.34800 |
|---|
| Density | 1.205 g/cm3 | Boiling Point | 481.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S,3S)-1,2-Epoxy-3-(Cbz-amino)-4-phenylbutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.205 g/cm3 |
|---|
| Boiling Point | 481.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19NO3 |
|---|
| Molecular Weight | 297.34800 |
|---|
| Exact Mass | 297.13600 |
|---|
| PSA | 50.86000 |
|---|
| LogP | 3.31380 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | DURMMNMFHRIMJD-DLBZAZTESA-N |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C1CO1)OCc1ccccc1 |
|---|
Synonyms
| [(1S)-1-(2S)-oxiranyl-2-phenylethyl]-carbaMic acid phenylMethyl ester |
| (1S,2S)-1-(N-benzyloxycarbonyl)-amino-2-phenylethyl-oxirane |
| N-benzyloxycarbonyl-3(S)-amino-1,2(S)-epoxy-4-phenylbutane |
| (1S,1'S)-1-(1'-N-benzyloxycarbonylamino-2'-phenyl)ethyloxirane |
| erythro N-Cbz-phenylalanyl epoxide |
| [S-(R*,R*)]-(1-oxiranyl-2-phenylethyl) carbamic acid phenylmethyl ester |
| (2S,3S)-1,2-Epoxy-3-(benzyloxycarbonyl-amino)-4-phenylbutane |
| (1S,2S)-Cbz epoxide |
