Introduction：Basic information about CAS 118292-06-1|6-Ethynyl-4,4-Dimethyl-Thiochroman, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Ethynyl-4,4-Dimethyl-Thiochroman |
|---|
| CAS Number | 118292-06-1 | Molecular Weight | 202.315 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 299.2±39.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14S | Melting Point | 69-72ºC |
|---|
| MSDS | / | Flash Point | 127.8±23.7 °C |
|---|
Names
| Name | 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 299.2±39.0 °C at 760 mmHg |
|---|
| Melting Point | 69-72ºC |
|---|
| Molecular Formula | C13H14S |
|---|
| Molecular Weight | 202.315 |
|---|
| Flash Point | 127.8±23.7 °C |
|---|
| Exact Mass | 202.081619 |
|---|
| PSA | 25.30000 |
|---|
| LogP | 4.64 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | KVHNVHGCQWNGLG-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1ccc2c(c1)C(C)(C)CCS2 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| 6-Ethynyl-4,4-Dimethyl-Thiochroman |
| 4,4-dimethyl-6-ethylyl-thiochroman |
| 2H-1-Benzothiopyran,6-ethynyl-3,4-dihydro-4,4-dimethyl |
| (4,4-dimethylthiochroman-6-yl)acetylene |
| 6-Ethynyl-4,4-dimethylthiochroman |
| 2H-1-Benzothiopyran, 6-ethynyl-3,4-dihydro-4,4-dimethyl- |
| 4,4-dimethyl-6-ethynyl-thiochromane |
| (4,4-dimethyl-thiochroman-6-yl)ethyne |
| 4,4-DIMETHYL-6-ETHYNYLTHIOCHROMAN |
| 6-Ethynyl-4,4-dimethylthiochromane |
