Introduction：Basic information about CAS 146406-75-9|4',4''''-(1,4-phenylene)bis(2,2':6',2''-t, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4',4''''-(1,4-phenylene)bis(2,2':6',2''-terpyridine) |
|---|
| CAS Number | 146406-75-9 | Molecular Weight | 540.61600 |
|---|
| Density | 1.227g/cm3 | Boiling Point | 727.8ºC at 760mmHg |
|---|
| Molecular Formula | C36H24N6 | Melting Point | 340ºC (dec.)(lit.) |
|---|
| MSDS | USA | Flash Point | 403.7ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-[4-(2,6-dipyridin-2-ylpyridin-4-yl)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.227g/cm3 |
|---|
| Boiling Point | 727.8ºC at 760mmHg |
|---|
| Melting Point | 340ºC (dec.)(lit.) |
|---|
| Molecular Formula | C36H24N6 |
|---|
| Molecular Weight | 540.61600 |
|---|
| Flash Point | 403.7ºC |
|---|
| Exact Mass | 540.20600 |
|---|
| PSA | 77.34000 |
|---|
| LogP | 8.05860 |
|---|
| Vapour Pressure | 3.5E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | NXMHYAQTBVTLRK-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)cc(-c3ccccn3)n2)nc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene |
| 4,4''''-(1,4-phenylene)bis(2,2':6',2''-terpyridine) |
| 1,4-bis(2,2'-:6',2''-terpyridin-4'-yl)benzene |
| 1,4-bis[2,2':6',2''-terpyridine-4'-yl]benzene |
| 1,4-bis(4'-phenyl-2,2':6',2''-terpyridin-4'-yl)benzene |
| MFCD02093699 |
| 4',4''''-(1,4-Phenylene)bis(2,2':6',2''-terpyridine) |
