Introduction:Basic information about CAS 30530-44-0|1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-FLUOROPHENYL)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(4-FLUOROPHENYL)- |
|---|
| CAS Number | 30530-44-0 | Molecular Weight | 205.19200 |
|---|
| Density | 1.433g/cm3 | Boiling Point | 486.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8FN5 | Melting Point | 276-280ºC(lit.) |
|---|
| MSDS | / | Flash Point | 247.8ºC |
|---|
Names
| Name | 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.433g/cm3 |
|---|
| Boiling Point | 486.1ºC at 760 mmHg |
|---|
| Melting Point | 276-280ºC(lit.) |
|---|
| Molecular Formula | C9H8FN5 |
|---|
| Molecular Weight | 205.19200 |
|---|
| Flash Point | 247.8ºC |
|---|
| Exact Mass | 205.07600 |
|---|
| PSA | 90.71000 |
|---|
| LogP | 2.00450 |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | UPQUQQDAZPFXCH-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(N)nc(-c2ccc(F)cc2)n1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| p-Fluorophenylguanamin |
| 2,4-Diamino-6-(p-fluorphenyl)-s-triazin |
| 6-(4-fluoro-phenyl)-[1,3,5]triazine-2,4-diamine |
| MFCD00737286 |
| 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine |
| [185] 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine |
| 4'-fluorobenzoguanamine |