Introduction：Basic information about CAS 870004-04-9|(4-Vinylphenyl)boronic acid, pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Vinylphenyl)boronic acid, pinacol ester |
|---|
| CAS Number | 870004-04-9 | Molecular Weight | 230.11000 |
|---|
| Density | 0.98±0.1g/ml(Predicted) | Boiling Point | 323.5±21.0℃(Predicted) |
|---|
| Molecular Formula | C14H19BO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 149 °C |
|---|
Names
| Name | 4,4,5,5-tetramethyl-2-(4-vinylphenyl)-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.98±0.1g/ml(Predicted) |
|---|
| Boiling Point | 323.5±21.0℃(Predicted) |
|---|
| Molecular Formula | C14H19BO2 |
|---|
| Molecular Weight | 230.11000 |
|---|
| Flash Point | 149 °C |
|---|
| Exact Mass | 230.14800 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 2.62880 |
|---|
| InChIKey | ONBKTEDYJFZZCU-UHFFFAOYSA-N |
|---|
| SMILES | C=Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-vinylaniline |
| aminostyrene |
| P-VINYLANILINE |
| Styrene-4-amine |
| 4-vinylphenylamine |
| 4-aminosrtyrene |
| 4-ethenyl-benzenamin |
| 4-BpinC6H4CH=CH2 |
| para amino vinyl benzene |
| 4-Ethenylaniline |
| p-amino-styrene |
| 4-vinylphenylpinacol-boronic ester |
| 4-Aminostryene |
| MFCD18733870 |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)styrene |
| 1,3,2-Dioxaborolane, 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl- |
| (4-Vinylphenyl)boronic acid, pinacol ester |
| 4-Vinylphenylboronic acid pinacol ester |
