Introduction：Basic information about CAS 95092-84-5|Ethyl 4-amino-1-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-amino-1-naphthoate |
|---|
| CAS Number | 95092-84-5 | Molecular Weight | 215.248 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 409.1±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.1±19.3 °C |
|---|
Names
| Name | Ethyl 4-amino-1-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 409.1±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H13NO2 |
|---|
| Molecular Weight | 215.248 |
|---|
| Flash Point | 240.1±19.3 °C |
|---|
| Exact Mass | 215.094635 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | PNCJAXRVSPZVNF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(N)c2ccccc12 |
|---|
Synonyms
| Ethyl 4-amino-1-naphthoate |
| 4-amino-1-methylimidazole-5-carboxylate ethyl ester |
| 5-amino-3-methyl-3H-imidazole-4-carboxylic acid ethyl ester |
| ethyl 4-amino-1-methyl-1H-imidazole-5-carboxylate |
| ethyl 4-amino-1-methylimidazole-5-carboxylate |
| 4-Ethoxycarbonyl-1-naphthylamine |
| 5-Amino-3-methyl-3H-imidazol-4-carbonsaeure-aethylester |
| 1-Naphthalenecarboxylic acid, 4-amino-, ethyl ester |
| ethyl4-aminonaphthalene-1-carboxylate |
