Introduction：Basic information about CAS 1120334-31-7|7-Nitro-2-phenyl-1H-indole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Nitro-2-phenyl-1H-indole-5-carboxylic acid |
|---|
| CAS Number | 1120334-31-7 | Molecular Weight | 282.251 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 587.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 309.1±30.1 °C |
|---|
Names
| Name | 7-Nitro-2-phenyl-1H-indole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 587.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10N2O4 |
|---|
| Molecular Weight | 282.251 |
|---|
| Flash Point | 309.1±30.1 °C |
|---|
| Exact Mass | 282.064056 |
|---|
| PSA | 98.91000 |
|---|
| LogP | 5.04 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.732 |
|---|
| InChIKey | VJPDDMKAPSYDDQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])c2[nH]c(-c3ccccc3)cc2c1 |
|---|
Synonyms
| 7-Nitro-2-phenyl-1H-indole-5-carboxylic acid |
| 2-phenyl-7-nitro-1H-indole-5-carboxylic acid |
| 1H-Indole-5-carboxylic acid, 7-nitro-2-phenyl- |
| Nat 02-761 |
| 7-Nitro-2-phenyl-1H-indole-5-carboxylicacid |
