Introduction：Basic information about CAS 867009-74-3|tert-butyl 1'-benzylspiro[2H-indole-3,4'-piperidine]-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 1'-benzylspiro[2H-indole-3,4'-piperidine]-1-carboxylate |
|---|
| CAS Number | 867009-74-3 | Molecular Weight | 378.50700 |
|---|
| Density | 1.166g/cm3 | Boiling Point | 489.452ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 249.812ºC |
|---|
Names
| Name | tert-butyl 1'-benzylspiro[2H-indole-3,4'-piperidine]-1-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.166g/cm3 |
|---|
| Boiling Point | 489.452ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30N2O2 |
|---|
| Molecular Weight | 378.50700 |
|---|
| Flash Point | 249.812ºC |
|---|
| Exact Mass | 378.23100 |
|---|
| PSA | 32.78000 |
|---|
| LogP | 4.97840 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | AIVKRCJBYDIBBC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(Cc3ccccc3)CC2)c2ccccc21 |
|---|
