Introduction：Basic information about CAS 352530-36-0|(2-Chloro-5-pyridyl)Methylzinc chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-Chloro-5-pyridyl)Methylzinc chloride |
|---|
| CAS Number | 352530-36-0 | Molecular Weight | 227.39700 |
|---|
| Density | 0.992 g/mL at 25ºC | Boiling Point | 65ºC |
|---|
| Molecular Formula | C6H5Cl2NZn | Melting Point | / |
|---|
| MSDS | / | Flash Point | 1 °F |
|---|
Names
| Name | 2-chloro-5-methanidylpyridine,chlorozinc(1+) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.992 g/mL at 25ºC |
|---|
| Boiling Point | 65ºC |
|---|
| Molecular Formula | C6H5Cl2NZn |
|---|
| Molecular Weight | 227.39700 |
|---|
| Flash Point | 1 °F |
|---|
| Exact Mass | 224.90900 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 2.73770 |
|---|
| InChIKey | PQSXTBMHLNJQKD-UHFFFAOYSA-M |
|---|
| SMILES | Cl[Zn+].[CH2-]c1ccc(Cl)nc1 |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Hazard Codes | F,Xi |
|---|
| Risk Phrases | R11;R19;R36/37 |
|---|
| Safety Phrases | S16;S26;S33 |
|---|
| RIDADR | UN 2056 3/PG 2 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| (2-chloro-pyrid-5-yl)methylzinc chloride |
| (2-Chloro-5-pyridyl)methylzinc chloride 0.5 M in Tetrahydrofuran |
| (2-chloropyridin-5-yl)methylzinc chloride |
| (2-Chloro-5-pyridyl)methylzinc chloride solution |
| (2-chloro-5-pyridylmethyl)zinc chloride |
| ((6-chloropyridin-3-yl)methyl)zinc(II) chloride |
| MFCD02260166 |
