Introduction：Basic information about CAS 14650-24-9|2-[[(heptadecafluorooctyl)sulphonyl]methylamino]ethyl methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[(heptadecafluorooctyl)sulphonyl]methylamino]ethyl methacrylate |
|---|
| CAS Number | 14650-24-9 | Molecular Weight | 625.29800 |
|---|
| Density | 1.579g/cm3 | Boiling Point | 363.4ºC at 760mmHg |
|---|
| Molecular Formula | C15H12F17NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.6ºC |
|---|
Names
| Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylmethylamino)ethyl 2-methylprop-2-enoate |
|---|
Chemical & Physical Properties
| Density | 1.579g/cm3 |
|---|
| Boiling Point | 363.4ºC at 760mmHg |
|---|
| Molecular Formula | C15H12F17NO4S |
|---|
| Molecular Weight | 625.29800 |
|---|
| Flash Point | 173.6ºC |
|---|
| Exact Mass | 625.02200 |
|---|
| PSA | 80.85000 |
|---|
| LogP | 6.50620 |
|---|
| Vapour Pressure | 1.81E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.361 |
|---|
| InChIKey | UZMOXNBUTMPDCX-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
