Introduction：Basic information about CAS 15942-08-2|Ambroxol Hydrochloride Impurity B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ambroxol Hydrochloride Impurity B |
|---|
| CAS Number | 15942-08-2 | Molecular Weight | 426.574 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H19Br2ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H19Br2ClN2O |
|---|
| Molecular Weight | 426.574 |
|---|
| Exact Mass | 423.955261 |
|---|
| PSA | 35.50000 |
|---|
| LogP | 4.57800 |
|---|
| InChIKey | ICLHRFYBPXBCPE-UHFFFAOYSA-N |
|---|
| SMILES | Cl.OC1CCC(N2CNc3c(Br)cc(Br)cc3C2)CC1 |
|---|
Synonyms
| Cyclohexanol, 4-(6,8-dibromo-1,4-dihydro-3(2H)-quinazolinyl)-, trans-, hydrochloride (1:1) |
| metabolites of Bisolvon |
| trans-4-(6,8-Dibromo-1,4-dihydro-3(2H)-quinazolinyl)cyclohexanol hydrochloride (1:1) |
| Ambroxol Hydrochloride Impurity B |
| EX-7791 |
| (1r,4r)-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride |
| Ambroxol Impurity 1 |
