Introduction：Basic information about CAS 5360-81-6|3-chloro-2,4,5,6-tetrafluorobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-2,4,5,6-tetrafluorobenzoic acid |
|---|
| CAS Number | 5360-81-6 | Molecular Weight | 228.52800 |
|---|
| Density | 1.747g/cm3 | Boiling Point | 252.9ºC at 760mmHg |
|---|
| Molecular Formula | C7HClF4O2 | Melting Point | 89-91°C |
|---|
| MSDS | / | Flash Point | 106.8ºC |
|---|
Names
| Name | 3-chloro-2,4,5,6-tetrafluorobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.747g/cm3 |
|---|
| Boiling Point | 252.9ºC at 760mmHg |
|---|
| Melting Point | 89-91°C |
|---|
| Molecular Formula | C7HClF4O2 |
|---|
| Molecular Weight | 228.52800 |
|---|
| Flash Point | 106.8ºC |
|---|
| Exact Mass | 227.96000 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.59460 |
|---|
| InChIKey | FYAPWZAOGRABCC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(F)c(F)c(F)c(Cl)c1F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| PC1734 |
| 3-ClC6F4COOH |
| 3-Chlortetrafluorbenzoesaeure |
| 5-Chlor-2,3,4,6-tetrafluor-benzoesaeure |
| 3-Chlor-2,4,5,6-tetrafluorbenzoesaeure |
| MFCD03001168 |
| 3-chloro-2,4,5,6-tetrafluoro-benzoic Acid |
