Introduction:Basic information about CAS 15599-52-7|8-Quinolinol,5,7-dibromo-2-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Quinolinol,5,7-dibromo-2-methyl- |
|---|
| CAS Number | 15599-52-7 | Molecular Weight | 316.97700 |
|---|
| Density | 1.934 g/cm3 | Boiling Point | 367.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7Br2NO | Melting Point | 126-130ºC(lit.) |
|---|
| MSDS | / | Flash Point | 176ºC |
|---|
Names
| Name | 5,7-dibromo-2-methylquinolin-8-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.934 g/cm3 |
|---|
| Boiling Point | 367.4ºC at 760 mmHg |
|---|
| Melting Point | 126-130ºC(lit.) |
|---|
| Molecular Formula | C10H7Br2NO |
|---|
| Molecular Weight | 316.97700 |
|---|
| Flash Point | 176ºC |
|---|
| Exact Mass | 314.88900 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.77380 |
|---|
| Vapour Pressure | 6.49E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | BNACJQWJZKPAPV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2c(Br)cc(Br)c(O)c2n1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5,7-Dibrom-2-methyl-chinolin-8-ol |
| 5,7-dibromo-2-methyl-quinolin-8-ol |
| 5,7-Dibromo-2-methyl-8-quinolinol |
| 5,7-Dibromo-8-hydroxyquinaldine |
| 5,7-dibromo-8-hydroxy-2-methylquinoline |
| 5,7-dibromo-2-methyl-8-hydroxyquinoline |
| Broquinaldol |