Introduction：Basic information about CAS 73862-12-1|2-[3-chloro-4-[(2-cyano-4-nitrophenyl)diazenyl]-N-(2-propanoyloxyethyl)anilino, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[3-chloro-4-[(2-cyano-4-nitrophenyl)diazenyl]-N-(2-propanoyloxyethyl)anilino]ethyl propanoate |
|---|
| CAS Number | 73862-12-1 | Molecular Weight | 501.92000 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 657.3ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24ClN5O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 351.3ºC |
|---|
Names
| Name | 2-[3-chloro-4-[(2-cyano-4-nitrophenyl)diazenyl]-N-(2-propanoyloxyethyl)anilino]ethyl propanoate |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 657.3ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24ClN5O6 |
|---|
| Molecular Weight | 501.92000 |
|---|
| Flash Point | 351.3ºC |
|---|
| Exact Mass | 501.14200 |
|---|
| PSA | 150.17000 |
|---|
| LogP | 5.77128 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | WJYMHQGRBUEXPP-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=O)OCCN(CCOC(=O)CC)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2C#N)c(Cl)c1 |
|---|
