Introduction：Basic information about CAS 73890-66-1|L-Alanine, N-(1-carboxyethyl)- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-Alanine, N-(1-carboxyethyl)- (9CI) |
|---|
| CAS Number | 73890-66-1 | Molecular Weight | 161.156 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 341.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H32ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.0±23.7 °C |
|---|
Names
| Name | butyl 3-[(3-butoxy-3-oxopropyl)-(3-chloropropyl)amino]propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 341.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H32ClNO4 |
|---|
| Molecular Weight | 161.156 |
|---|
| Flash Point | 160.0±23.7 °C |
|---|
| Exact Mass | 161.068802 |
|---|
| PSA | 55.84000 |
|---|
| LogP | -0.71 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.489 |
|---|
Synonyms
| (2S)-2,2'-iminodipropanoic acid (non-preferred name) |
| DL-2,2'-Imino-dipropionsaeure |
| Dibutyl N-(3-chloropropyl)imino-3,3'-dipropionate |
| (2'S)-2,2'-Iminodipropanoic acid |
| 2,2'-imino-dipropionic acid |
| dibutyl 3,3'-[(3-chloropropyl)imino]dipropanoate(non-preferred name) |
| (R*,R*)-N-(1-carboxyethyl)-DL-alanine |
| DL-2,2'-imino-dipropionic acid |
| Acide dimethyl-2,4 aza-3 pentanedioique-1,5 |
| 2,2'-Imino-di-propionsaeure |
| L-Alanine, N-(1-carboxyethyl)- (9CI) |
