Introduction：Basic information about CAS 83249-10-9|Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid monomethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid monomethyl ester |
|---|
| CAS Number | 83249-10-9 | Molecular Weight | 170.163 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 272.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10O4 | Melting Point | 139.5-140.2 ºC (hexane ) |
|---|
| MSDS | / | Flash Point | 111.2±20.8 °C |
|---|
Names
| Name | 3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 272.2±40.0 °C at 760 mmHg |
|---|
| Melting Point | 139.5-140.2 ºC (hexane ) |
|---|
| Molecular Formula | C8H10O4 |
|---|
| Molecular Weight | 170.163 |
|---|
| Flash Point | 111.2±20.8 °C |
|---|
| Exact Mass | 170.057907 |
|---|
| PSA | 66.43000 |
|---|
| LogP | 0.22 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | UJZHYIMESNWEQA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C12CC(C(=O)O)(C1)C2 |
|---|
| Water Solubility | Sparingly soluble (14 g/L) (25 ºC) |
|---|
Synonyms
| 3-carbomethoxybicyclo<1.1.1>pentane-1-carboxylic acid |
| methyl 3-carboxybicyclo<1,1,1>pentane-1-carboxylate |
| Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid monomethyl ester |
| 3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| 3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid |
