Introduction:Basic information about CAS 9072-91-7|1,3-diisocyanato-2-methylbenzene,ethane-1,2-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-diisocyanato-2-methylbenzene,ethane-1,2-diol |
|---|
| CAS Number | 9072-91-7 | Molecular Weight | 236.22400 |
|---|
| Density | / | Boiling Point | 248.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.5ºC |
|---|
Names
| Name | 1,3-diisocyanato-2-methylbenzene,ethane-1,2-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 248.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O4 |
|---|
| Molecular Weight | 236.22400 |
|---|
| Flash Point | 110.5ºC |
|---|
| Exact Mass | 236.08000 |
|---|
| PSA | 99.32000 |
|---|
| LogP | 0.90060 |
|---|
| InChIKey | DZJIWJYGQQAKIJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(N=C=O)cccc1N=C=O.OCCO |
|---|
Synonyms
| Toluene diisocyanate,ethylene glycol polymer |
| 1,2-Ethanediol,polymer with 1,3-diisocyanatomethylbenzene |