Introduction：Basic information about CAS 952182-27-3|1-O-tert-butyl 3-O-methyl pyrrole-1,3-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-O-tert-butyl 3-O-methyl pyrrole-1,3-dicarboxylate |
|---|
| CAS Number | 952182-27-3 | Molecular Weight | 225.24100 |
|---|
| Density | 1.118g/cm3 | Boiling Point | 302.815ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.938ºC |
|---|
Names
| Name | 1-O-tert-butyl 3-O-methyl pyrrole-1,3-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.118g/cm3 |
|---|
| Boiling Point | 302.815ºC at 760 mmHg |
|---|
| Molecular Formula | C11H15NO4 |
|---|
| Molecular Weight | 225.24100 |
|---|
| Flash Point | 136.938ºC |
|---|
| Exact Mass | 225.10000 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.05790 |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | CTHZHSWSRBKAAA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccn(C(=O)OC(C)(C)C)c1 |
|---|
Synonyms
| 1-tert-butyl 3-methyl pyrrole-1,3-dicarboxylate |
| 1-tert-Butyl 3-methyl 1H-pyrrole-1,3-dicarboxylate |
| methyl 1-boc-1h-pyrrole-3-carboxylate |
| Methyl 1-(tert-butoxycarbonyl)-1H-pyrrole-3-carboxylate |
| Methyl 1H-pyrrole-3-carboxylate,N-BOC protected |
