Introduction：Basic information about CAS 57022-38-5|Carcinine dihydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carcinine dihydrochloride |
|---|
| CAS Number | 57022-38-5 | Molecular Weight | 255.14500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H16Cl2N4O | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide,dihydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H16Cl2N4O |
|---|
| Molecular Weight | 255.14500 |
|---|
| Exact Mass | 254.07000 |
|---|
| PSA | 87.29000 |
|---|
| LogP | 2.56180 |
|---|
| InChIKey | ZQTUNIWBUQUKAM-UHFFFAOYSA-N |
|---|
| SMILES | Cl.Cl.NCCC(=O)NCCc1cnc[nH]1 |
|---|
| Storage condition | 20°C |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | 37/38-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Carcinine dihydrochloride |
| Prestwick_701 |
| Decarboxy carnosine HCl |
| Carcinine hydrochloride |
| UNII-6X7K9I5QR7 |
| 6X7K9I5QR7 |
