Introduction：Basic information about CAS 59225-85-3|(2,4,6-trichlorophenyl) 3-oxobutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,4,6-trichlorophenyl) 3-oxobutanoate |
|---|
| CAS Number | 59225-85-3 | Molecular Weight | 281.52000 |
|---|
| Density | 1.458g/cm3 | Boiling Point | 383.9ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7Cl3O3 | Melting Point | 56-58ºC |
|---|
| MSDS | / | Flash Point | 162.2ºC |
|---|
Names
| Name | (2,4,6-trichlorophenyl) 3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Boiling Point | 383.9ºC at 760 mmHg |
|---|
| Melting Point | 56-58ºC |
|---|
| Molecular Formula | C10H7Cl3O3 |
|---|
| Molecular Weight | 281.52000 |
|---|
| Flash Point | 162.2ºC |
|---|
| Exact Mass | 279.94600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.53130 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | SFXGTKMFWDFCLU-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Oc1c(Cl)cc(Cl)cc1Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| (2',4',6'-trichlorophenyl) 3-oxobutanoate |
| 2,4,6-Trichlorophenyl acetoacetate |
| Acetessigsaeure-2.4.6-trichlorphenylester |
| EINECS 261-667-3 |
| Acetoacetic acid 2,4,6-trichlorophenyl ester |
