Introduction：Basic information about CAS 59583-77-6|2-[butyl[4-(2,2-dicyanovinyl)-3-methylphenyl]amino]ethyl (3,4-dichlorophenyl)c, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[butyl[4-(2,2-dicyanovinyl)-3-methylphenyl]amino]ethyl (3,4-dichlorophenyl)carbamate |
|---|
| CAS Number | 59583-77-6 | Molecular Weight | 266.25000 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 606.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320.8ºC |
|---|
Names
| Name | ethyl 2-[2-(4-methoxybenzoyl)hydrazinyl]-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 606.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O5 |
|---|
| Molecular Weight | 266.25000 |
|---|
| Flash Point | 320.8ºC |
|---|
| Exact Mass | 266.09000 |
|---|
| PSA | 100.71000 |
|---|
| LogP | 1.43440 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | YCNGUBLHXKRMKK-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCOC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(C=C(C#N)C#N)c(C)c1 |
|---|
Synonyms
| ethyl[2-(4-methoxybenzoyl)hydrazinyl](oxo)acetate |
| EINECS 260-983-9 |
| Ethyl (2'-(4-methoxybenzoyl)hydrazido)oxalate |
