Introduction：Basic information about CAS 596-56-5|diatropic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diatropic acid |
|---|
| CAS Number | 596-56-5 | Molecular Weight | 296.31700 |
|---|
| Density | 1.326g/cm3 | Boiling Point | 449.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.5ºC |
|---|
Names
| Name | 2-phenylprop-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.326g/cm3 |
|---|
| Boiling Point | 449.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16O4 |
|---|
| Molecular Weight | 296.31700 |
|---|
| Flash Point | 239.5ºC |
|---|
| Exact Mass | 296.10500 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.56880 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | LRUSLZFPYBAMCI-KSSFIOAISA-N |
|---|
| SMILES | O=C(O)C1CCC(C(=O)O)(c2ccccc2)c2ccccc21 |
|---|
Synonyms
| diatropic acid |
| (+-)-2-Phenyl-1,2,3,4-tetrahydro-naphthalin-1r,4c-dicarbonsaeure |
