Introduction：Basic information about CAS 597-59-1|2-hydroxypropane-1,2,3-tricarboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-hydroxypropane-1,2,3-tricarboxamide |
|---|
| CAS Number | 597-59-1 | Molecular Weight | 189.16900 |
|---|
| Density | 1.483g/cm3 | Boiling Point | 697.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H11N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 375.5ºC |
|---|
Names
| Name | 2-hydroxypropane-1,2,3-tricarboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.483g/cm3 |
|---|
| Boiling Point | 697.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H11N3O4 |
|---|
| Molecular Weight | 189.16900 |
|---|
| Flash Point | 375.5ºC |
|---|
| Exact Mass | 189.07500 |
|---|
| PSA | 152.47000 |
|---|
| LogP | 0.40270 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | MPQPXMRGNQJXGO-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)CC(O)(CC(N)=O)C(N)=O |
|---|
Synonyms
| Citronensaeure-triamid |
| Citric acid triamide |
| 2-hydroxy-1,2,3-propanetricarboxamide |
| Citramide |
| Citramide(6CI) |
| EINECS 209-904-1 |
| Citrotriamid |
