Introduction:Basic information about CAS 5335-87-5|p-methoxyphenyl disulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-methoxyphenyl disulfide |
|---|
| CAS Number | 5335-87-5 | Molecular Weight | 278.390 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 395.1±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S2 | Melting Point | 41-45 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 192.8±23.7 °C |
|---|
| Symbol | GHS05, GHS09 | Signal Word | Danger |
|---|
Names
| Name | Bis(4-methoxyphenyl) disulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 395.1±27.0 °C at 760 mmHg |
|---|
| Melting Point | 41-45 °C(lit.) |
|---|
| Molecular Formula | C14H14O2S2 |
|---|
| Molecular Weight | 278.390 |
|---|
| Flash Point | 192.8±23.7 °C |
|---|
| Exact Mass | 278.043518 |
|---|
| PSA | 69.06000 |
|---|
| LogP | 4.30 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | PZQGLCGLPMWYBT-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(SSc2ccc(OC)cc2)cc1 |
|---|
Safety Information
| Symbol | GHS05, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318-H410 |
|---|
| Precautionary Statements | P273-P280-P305 + P351 + P338-P501 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S60-S61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Bis(4-methoxyphenyl) disulfide |
| Bis(p-methoxyphenyl)disulfide |
| p-methoxyphenyl disulfide |
| 1,1'-Disulfanediylbis(4-methoxybenzene) |
| 4,4'-Dimethoxy diphenyldisulfide |
| 1-methoxy-4-[(4-methoxyphenyl)disulfanyl]benzene |
| Disulfide, bis(4-methoxyphenyl) |
| MFCD00041358 |
| BIS(4-METHOXYPHENYL) DISULPHIDE |