Introduction：Basic information about CAS 20730-58-9|4-(2-METHOXYPHENYL)HEPTANE-3,5-DIONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-METHOXYPHENYL)HEPTANE-3,5-DIONE |
|---|
| CAS Number | 20730-58-9 | Molecular Weight | 282.28900 |
|---|
| Density | 1.158g/cm3 | Boiling Point | 351.331ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.845ºC |
|---|
Names
| Name | diethyl 2-(2-methoxyphenoxy)propanedioate |
|---|
Chemical & Physical Properties
| Density | 1.158g/cm3 |
|---|
| Boiling Point | 351.331ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O6 |
|---|
| Molecular Weight | 282.28900 |
|---|
| Flash Point | 151.845ºC |
|---|
| Exact Mass | 282.11000 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 1.56880 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.493 |
|---|
| InChIKey | QPUXZGQASDDLMQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Oc1ccccc1OC)C(=O)OCC |
|---|
