Introduction：Basic information about CAS 1414455-03-0|Guajadial B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Guajadial B |
|---|
| CAS Number | 1414455-03-0 | Molecular Weight | 474.588 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 522.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H34O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.0±23.6 °C |
|---|
Names
| Name | Guajadial B |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 522.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H34O5 |
|---|
| Molecular Weight | 474.588 |
|---|
| Flash Point | 161.0±23.6 °C |
|---|
| Exact Mass | 474.240631 |
|---|
| PSA | 83.83000 |
|---|
| LogP | 10.80 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | SCJBVAONMYLOHE-AHIASQOTSA-N |
|---|
| SMILES | CC1=CCC(C)(C)C=CCC2(C)Oc3c(C=O)c(O)c(C=O)c(O)c3C(c3ccccc3)C2CC1 |
|---|
Safety Information
Synonyms
| Guajadial B |
| Benzo[b]cycloundeca[e]pyran-2,4-dicarboxaldehyde, 5a,6,9,10,13,14,14a,15-octahydro-1,3-dihydroxy-5a,9,9,12-tetramethyl-15-phenyl-, (5aS,7E,11E,14aR,15S)- |
| (5aS,7E,11E,14aR,15S)-1,3-Dihydroxy-5a,9,9,12-tetramethyl-15-phenyl-5a,6,9,10,13,14,14a,15-octahydrocycloundeca[b]chromene-2,4-dicarbaldehyde |
