Introduction：Basic information about CAS 75748-36-6|H-D-Thr-OBzl.HCl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-D-Thr-OBzl.HCl |
|---|
| CAS Number | 75748-36-6 | Molecular Weight | 245.703 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H16ClNO3 | Melting Point | 128.0 to 132.0 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzyl (2R,3S)-2-amino-3-hydroxybutanoate,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 128.0 to 132.0 °C |
|---|
| Molecular Formula | C11H16ClNO3 |
|---|
| Molecular Weight | 245.703 |
|---|
| Exact Mass | 245.081863 |
|---|
| PSA | 72.55000 |
|---|
| LogP | 1.94020 |
|---|
| InChIKey | IDZGTFSDZJVMSD-KXNXZCPBSA-N |
|---|
| SMILES | CC(O)C(N)C(=O)OCc1ccccc1.Cl |
|---|
Synonyms
| H-D-Thr-OBzl.HCl |
| D-Allothreonine, phenylmethyl ester, hydrochloride (1:1) |
| Benzyl D-threoninate hydrochloride (1:1) |
| D-Threonine Benzyl Ester Hydrochloride |
| Benzyl D-allothreoninate hydrochloride (1:1) |
| D-Threonine, phenylmethyl ester, hydrochloride (1:1) |
| T2788 |
