Introduction：Basic information about CAS 541503-81-5|Vicriviroc Malate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vicriviroc Malate |
|---|
| CAS Number | 541503-81-5 | Molecular Weight | 667.716 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H44F3N5O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4,6-dimethylpyrimidin-5-yl)-[4-[(3S)-4-[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methylpiperazin-1-yl]-4-methylpiperidin-1-yl]methanone,2-hydroxybutanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C32H44F3N5O7 |
|---|
| Molecular Weight | 667.716 |
|---|
| Exact Mass | 667.319275 |
|---|
| PSA | 156.63000 |
|---|
| LogP | 3.22100 |
|---|
| InChIKey | HQJIGHNTROUVLT-RIAYWLAYSA-N |
|---|
| SMILES | COCC(c1ccc(C(F)(F)F)cc1)N1CCN(C2(C)CCN(C(=O)c3c(C)ncnc3C)CC2)CC1C.O=C(O)CC(O)C(=O)O |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| Vicriviroc Malate-Supplied by Selleck Chemicals |
| X5032 |
| Butanedioic acid, 2-hydroxy-, compd. with (4,6-dimethyl-5-pyrimidinyl)[4-[4-[2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methyl-1-piperazinyl]-4-methyl-1-piperidinyl]methanone (1:1) |
| Vicriviroc Malate |
| 2-Hydroxysuccinic acid - (4,6-dimethyl-5-pyrimidinyl)[4-(4-{2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl}-3-methyl-1-piperazinyl)-4-methyl-1-piperidinyl]methanone (1:1) |
| X7271 |
| S2004_Selleck |
