Introduction：Basic information about CAS 684270-46-0|Fmoc-β-azido-Ala-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-β-azido-Ala-OH |
|---|
| CAS Number | 684270-46-0 | Molecular Weight | 352.344 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H16N4O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | (2S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H16N4O4 |
|---|
| Molecular Weight | 352.344 |
|---|
| Exact Mass | 352.117157 |
|---|
| PSA | 128.87000 |
|---|
| LogP | 4.14 |
|---|
| InChIKey | ZITYCUDVCWLHPG-INIZCTEOSA-N |
|---|
| SMILES | [N-]=[N+]=NCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| AmbotzFAA1820 |
| Fmoc-|A-azido-Ala-OH |
| Fmoc-3-azido-L-alanine |
| L-Alanine, 3-azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| 3-Azido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine |
| Fmoc-β-azido-Ala-OH |
| 3-azido-N-Fmoc-L-ala-OH |
