Introduction：Basic information about CAS 1100-88-5|Benzyltriphenylphosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyltriphenylphosphonium chloride |
|---|
| CAS Number | 1100-88-5 | Molecular Weight | 388.869 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C25H22ClP | Melting Point | 337 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 300°C |
|---|
| Symbol |
GHS06, GHS09 | Signal Word | Danger |
|---|
Names
| Name | Benzyltriphenylphosphonium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 337 °C |
|---|
| Molecular Formula | C25H22ClP |
|---|
| Molecular Weight | 388.869 |
|---|
| Flash Point | 300°C |
|---|
| Exact Mass | 388.114777 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 2.18470 |
|---|
| InChIKey | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
|---|
| SMILES | [Cl-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
| Water Solubility | SOLUBLE |
|---|
Safety Information
| Symbol |
GHS06, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H300 + H330-H311-H315-H319-H335-H411 |
|---|
| Precautionary Statements | P260-P273-P280-P301 + P310 + P330-P304 + P340 + P310-P403 + P233 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T:Toxic |
|---|
| Risk Phrases | R24/25;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 2811 6.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | TA2416500 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 29310095 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Triphenylbenzylidenephosphorane |
| EINECS 214-154-3 |
| Benzyl(triphenyl)phosphonium chloride |
| BPP |
| Phosphonium, triphenyl(phenylmethyl)-, chloride (1:1) |
| benzyl triphenylphosphonium chloride |
| benzyl (triphenyl)phosphonium chloride |
| Benzyl triphenyl phosphonium chloride |
| Benzyltriphenylchlorophosphine |
| Phosphonium, benzyltriphenyl-, chloride (8CI) |
| Triphenylbenzylphosphonium chloride |
| MFCD02177525 |
| benzyltriphenilphosphonium chloride |
| AURORA KA-1173 |
| benzyltriphenyl-phosphoniuchloride |
| C6H5CH2PPh3Cl |
| Benzyltriphenylphosp |
| benzyltriphenylphosphonidechloride |
| Benzyltriphenylphosphonium chloride |
