Introduction：Basic information about CAS 2627-95-4|Divinyltetramethyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Divinyltetramethyldisiloxane |
|---|
| CAS Number | 2627-95-4 | Molecular Weight | 186.399 |
|---|
| Density | 0.8±0.1 g/cm3 | Boiling Point | 139.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H18OSi2 | Melting Point | −99 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 33.3±19.1 °C |
|---|
| Symbol |
GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | Divinyltetramethyldisiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.8±0.1 g/cm3 |
|---|
| Boiling Point | 139.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | −99 °C(lit.) |
|---|
| Molecular Formula | C8H18OSi2 |
|---|
| Molecular Weight | 186.399 |
|---|
| Flash Point | 33.3±19.1 °C |
|---|
| Exact Mass | 186.089615 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.15 |
|---|
| Vapour Pressure | 8.2±0.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.419 |
|---|
| InChIKey | BITPLIXHRASDQB-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C=C |
|---|
| Storage condition | Flammables area |
|---|
| Water Solubility | insoluble |
|---|
Safety Information
| Symbol |
GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H315-H319-H335 |
|---|
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | F:Flammable |
|---|
| Risk Phrases | R10;R36/37/38 |
|---|
| Safety Phrases | S16-S26-S36-S37/39 |
|---|
| RIDADR | UN 1993 3/PG 2 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | JM9235250 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3,3,5,5-tetramethyl-3,5-disila-4-oxa-1,6-heptadiene |
| Divinyltetramethyldi |
| EINECS 220-099-6 |
| 1,3-DivinyltetraMethyldisiloxane |
| Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl- |
| 1,1,3,3-Tetramethyl-1,3-divinyldisiloxane |
| Tetramethyldivinylsiloxane |
| Bisvinyltetramethyldisiloxane |
| 1,3-diethenyl-1,1,3,3-tetramethyldisiloxane |
| CD6210 |
| Tetramethyl-1,3-divinyldisiloxane |
| MFCD00014933 |
| 1,3-divinyl-1,1,3,3-tetramethyl-disiloxane |
| Disiloxane, 1,1,3,3-tetramethyl-1,3-divinyl- |
| tetramethyldivinyldisiloxane |
| Mulberry Extract |
