Introduction:Basic information about CAS 511272-34-7|Fmoc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid |
|---|
| CAS Number | 511272-34-7 | Molecular Weight | 403.42700 |
|---|
| Density | 1.334g/cm3 | Boiling Point | 660.8ºC at 760 mmHg |
|---|
| Molecular Formula | C24H21NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 353.4ºC |
|---|
Names
| Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxyphenyl)propanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.334g/cm3 |
|---|
| Boiling Point | 660.8ºC at 760 mmHg |
|---|
| Molecular Formula | C24H21NO5 |
|---|
| Molecular Weight | 403.42700 |
|---|
| Flash Point | 353.4ºC |
|---|
| Exact Mass | 403.14200 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 4.83760 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | JYMPQFLSLFTILZ-OAQYLSRUSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1O |
|---|