Introduction：Basic information about CAS 384-83-8|2,3,4,5,6-pentachloro(trifluoromethyl) benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,6-pentachloro(trifluoromethyl) benzene |
|---|
| CAS Number | 384-83-8 | Molecular Weight | 318.33500 |
|---|
| Density | 1.742 g/cm3 | Boiling Point | 279ºC at 760 mmHg |
|---|
| Molecular Formula | C7Cl5F3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 140ºC |
|---|
Names
| Name | 1,2,3,4,5-pentachloro-6-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.742 g/cm3 |
|---|
| Boiling Point | 279ºC at 760 mmHg |
|---|
| Molecular Formula | C7Cl5F3 |
|---|
| Molecular Weight | 318.33500 |
|---|
| Flash Point | 140ºC |
|---|
| Exact Mass | 315.83900 |
|---|
| LogP | 5.97240 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | OFYUASAFKNCGBJ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene,pentachloro(trifluoromethyl) |
| Pentachlor-trifluormethyl-benzol |
| Benzene,1,2,3,4,5-pentachloro-6-(trifluoromethyl) |
| U649 |
| 2,3,4,5,6-pentachloro-1-(trifluoromethyl)benzene |
| pentachlorobenzotrifluoride |
| Pentachlor-benzo-trifluorid |
| 2,3,4,5,6-Pentachloro(trifluoromethyl)benzene |
| pentachloro-trifluoromethyl-benzene |
