Introduction：Basic information about CAS 209683-39-6|1,5-bis(p-hexyloxyphenyl)-1,4-pentadien-3-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,5-bis(p-hexyloxyphenyl)-1,4-pentadien-3-one |
|---|
| CAS Number | 209683-39-6 | Molecular Weight | 434.61000 |
|---|
| Density | 1.02g/cm3 | Boiling Point | 592.7ºC at 760 mmHg |
|---|
| Molecular Formula | C29H38O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 305.2ºC |
|---|
Names
| Name | 1,5-bis(p-hexyloxyphenyl)-1,4-pentadien-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.02g/cm3 |
|---|
| Boiling Point | 592.7ºC at 760 mmHg |
|---|
| Molecular Formula | C29H38O3 |
|---|
| Molecular Weight | 434.61000 |
|---|
| Flash Point | 305.2ºC |
|---|
| Exact Mass | 434.28200 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 7.90050 |
|---|
| Vapour Pressure | 5.11E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | XKEDONQIWMPPPP-JYFOCSDGSA-N |
|---|
| SMILES | CCCCCCOc1ccc(C=CC(=O)C=Cc2ccc(OCCCCCC)cc2)cc1 |
|---|
Synonyms
| 1,5-bis-(4-hexyloxy-phenyl)-penta-1,4-dien-3-one |
| 1,5-Bis(4-hexyloxyphenyl)-1,4-pentadien-3-one |
