Introduction：Basic information about CAS 30006-03-2|3-Benzoyl-2-thiophenecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Benzoyl-2-thiophenecarboxylic acid |
|---|
| CAS Number | 30006-03-2 | Molecular Weight | 232.25500 |
|---|
| Density | 1.369 g/cm3 | Boiling Point | 206-210 °C(lit.) |
|---|
| Molecular Formula | C12H8O3S | Melting Point | 86-89 °C(lit.) |
|---|
| MSDS | / | Flash Point | 90 °C |
|---|
Names
| Name | 3-benzoylthiophene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.369 g/cm3 |
|---|
| Boiling Point | 206-210 °C(lit.) |
|---|
| Melting Point | 86-89 °C(lit.) |
|---|
| Molecular Formula | C12H8O3S |
|---|
| Molecular Weight | 232.25500 |
|---|
| Flash Point | 90 °C |
|---|
| Exact Mass | 232.01900 |
|---|
| PSA | 82.61000 |
|---|
| LogP | 2.67730 |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | ZKHLBCVFVQJMBT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1ccsc1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. |
|---|
| Safety Phrases | S36/37/39 |
|---|
| WGK Germany | 1 |
|---|
| RTECS | GW1925000 |
|---|
| HS Code | 29280090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Benzoylthiophen-2-carbonsaeure |
| 3-benzoyl-thiophene-2-carboxylic acid |
| 3-benzoyl-2-thiophenecarboxylic acid |
| MFCD00159542 |
| 3-Benzoylthiophene-2-carboxylic acid |
