Introduction：Basic information about CAS 1912-47-6|2-(5-Methyl-1H-indol-3-yl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(5-Methyl-1H-indol-3-yl)acetic acid |
|---|
| CAS Number | 1912-47-6 | Molecular Weight | 189.210 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 420.8±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2 | Melting Point | 127-128 °C(lit.) |
|---|
| MSDS | / | Flash Point | 208.3±24.6 °C |
|---|
Names
| Name | 2-(5-methyl-1H-indol-3-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 420.8±30.0 °C at 760 mmHg |
|---|
| Melting Point | 127-128 °C(lit.) |
|---|
| Molecular Formula | C11H11NO2 |
|---|
| Molecular Weight | 189.210 |
|---|
| Flash Point | 208.3±24.6 °C |
|---|
| Exact Mass | 189.078979 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 1.89 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | VYFDKXJAORBSAW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2[nH]cc(CC(=O)O)c2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 5-Methyl-indolyl-3-essigsaeure |
| (5-Methyl-indol-3-yl)-essigsaeure |
| AmbotzHAA8290 |
| 1H-Indole-3-acetic acid, 5-methyl- |
| 2-(5-methyl-1H-indol-3-yl)acetic acid |
| 1h-indole-3-acetic acid,5-methyl |
| (5-Methyl-1H-indol-3-yl)acetic acid |
| 5-Methyl-3-essigsaeure |
| 5-methylindol-3-ylacetic acid |
| 5-methylindole-3-acetic acid |
| MFCD00022751 |
