Introduction:Basic information about CAS 73458-39-6|5-Nitrobenzo[d]thiazol-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitrobenzo[d]thiazol-2-amine |
|---|
| CAS Number | 73458-39-6 | Molecular Weight | 195.199 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 411.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.8±26.5 °C |
|---|
Names
| Name | 5-nitro-1,3-benzothiazol-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 411.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5N3O2S |
|---|
| Molecular Weight | 195.199 |
|---|
| Flash Point | 202.8±26.5 °C |
|---|
| Exact Mass | 195.010239 |
|---|
| PSA | 112.97000 |
|---|
| LogP | 1.62 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.798 |
|---|
| InChIKey | FISVWAMPAATJLP-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc2cc([N+](=O)[O-])ccc2s1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2934200090 |
|---|
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-nitro-1,3-benzothiazol-2-amine |
| 2-amino-5-nitrobenzothiazole |
| 5-nitrobenzothiazol-2-amine |
| MFCD00160073 |
| 2-Benzothiazolamine, 5-nitro- |
| 5-Nitrobenzothiazol-2-ylamine |
| 5-Nitro-2-amino-benzthiazol |
| 5-nitrobenzo[d]thiazol-2-amine |
| 2-Amino-5-nitrobenzothizole |
| 2-amino-5-nitro-1,3-benzothiazole |
| 5-Nitro-benzothiazol-2-ylamine |