Introduction：Basic information about CAS 15351-13-0|Nicofuranose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nicofuranose |
|---|
| CAS Number | 15351-13-0 | Molecular Weight | 600.53200 |
|---|
| Density | 1.5 g/cm3 | Boiling Point | 756ºC at 760 mmHg |
|---|
| Molecular Formula | C30H24N4O10 | Melting Point | 133-136ºC |
|---|
| MSDS | USA | Flash Point | 411ºC |
|---|
Names
| Name | nicofuranose |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5 g/cm3 |
|---|
| Boiling Point | 756ºC at 760 mmHg |
|---|
| Melting Point | 133-136ºC |
|---|
| Molecular Formula | C30H24N4O10 |
|---|
| Molecular Weight | 600.53200 |
|---|
| Flash Point | 411ºC |
|---|
| Exact Mass | 600.14900 |
|---|
| PSA | 186.22000 |
|---|
| LogP | 1.81900 |
|---|
| Vapour Pressure | 7.66E-26mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | FUWFSXZKBMCSKF-ZASNTINBSA-N |
|---|
| SMILES | O=C(OCC1OC(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1OC(=O)c1cccnc1)c1cccnc1 |
|---|
Safety Information
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 22-36/37/39 |
|---|
Synonyms
| MFCD00868276 |
| 1,3,4,6-Tetrakis-O-(3-pyridinylcarbonyl)hex-2-ulofuranose |
| 1,3,3,6-tetranicotinyl-D-fructose |
| EINECS 239-385-7 |
| D-Fructofuranose 1,3,4,6-tetranicotinate |
| L-Nicofuranosum |
| ES-304 |
| Vasperdil |
| Bradilan |
