Introduction:Basic information about CAS 215778-81-7|4-(chloromethyl)-2-(4-pentylphenyl)-1,3-thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(chloromethyl)-2-(4-pentylphenyl)-1,3-thiazole |
|---|
| CAS Number | 215778-81-7 | Molecular Weight | 279.82800 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 406.4ºC at 760mmHg |
|---|
| Molecular Formula | C15H18ClNS | Melting Point | 59ºC |
|---|
| MSDS | / | Flash Point | 199.6ºC |
|---|
Names
| Name | 4-(chloromethyl)-2-(4-pentylphenyl)-1,3-thiazole |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 406.4ºC at 760mmHg |
|---|
| Melting Point | 59ºC |
|---|
| Molecular Formula | C15H18ClNS |
|---|
| Molecular Weight | 279.82800 |
|---|
| Flash Point | 199.6ºC |
|---|
| Exact Mass | 279.08500 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 5.28160 |
|---|
| Vapour Pressure | 1.92E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | CLYMMYUMRHKSNK-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCc1ccc(-c2nc(CCl)cs2)cc1 |
|---|