Introduction：Basic information about CAS 2611-00-9|3-Cyclohexenyl 3-cyclohexene 1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Cyclohexenyl 3-cyclohexene 1-carboxylate |
|---|
| CAS Number | 2611-00-9 | Molecular Weight | 220.307 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 303.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H20O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 130.2±9.6 °C |
|---|
Names
| Name | cyclohex-3-en-1-ylmethyl cyclohex-3-ene-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 303.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H20O2 |
|---|
| Molecular Weight | 220.307 |
|---|
| Flash Point | 130.2±9.6 °C |
|---|
| Exact Mass | 220.146332 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.09 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | FJPFRSQDAFMEKD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC1CC=CCC1)C1CC=CCC1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916209090 |
|---|
Customs
| HS Code | 2916209090 |
|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-cyclohexenylmethyl 3-cyclohexene-1-carboxylate |
| EINECS 220-031-5 |
| Cyclohex-3-en-1-ylmethyl cyclohex-3-enecarboxylate |
| 3-Cyclohexenyl 3-cyclohexene 1-carboxylate |
| cyclohex-3-en-1-ylmethyl cyclohex-3-ene-1-carboxylate |
| 3-Cyclohexene-1-carboxylic acid, 3-cyclohexen-1-ylmethyl ester |
| Cyclohex-3-enylmethyl cyclohex-3-enecarboxylate |
| 3-Cyclohexene-1-carboxylic acid,3-cyclohexen-1-ylmethyl ester |
| (3-cyclohexenyl)methyl 3-cyclohexenecarboxylate |
| Diene 221 |
| Cyclohex-3-encarbonsaeure-cyclohex-3-enylmethylester |
| 3-Cyclohexen-1-ylmethyl 3-cyclohexene-1-carboxylate |
| 3-Cyclohexenyl-methyl-3'-cyclohexen-carboxylat |
| cyclohex-3-enecarboxylic acid cyclohex-3-enylmethyl ester |
