Introduction：Basic information about CAS 42288-08-4|3-methyl-3-(4-methylphenyl)butanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-methyl-3-(4-methylphenyl)butanoic acid |
|---|
| CAS Number | 42288-08-4 | Molecular Weight | 192.25400 |
|---|
| Density | 1.047g/cm3 | Boiling Point | 306.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H16O2 | Melting Point | 75ºC |
|---|
| MSDS | / | Flash Point | 203.6ºC |
|---|
Names
| Name | 3-methyl-3-(4-methylphenyl)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.047g/cm3 |
|---|
| Boiling Point | 306.5ºC at 760mmHg |
|---|
| Melting Point | 75ºC |
|---|
| Molecular Formula | C12H16O2 |
|---|
| Molecular Weight | 192.25400 |
|---|
| Flash Point | 203.6ºC |
|---|
| Exact Mass | 192.11500 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.74730 |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | LXMASNUOAKLCJK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(C)(C)CC(=O)O)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Methyl-3-p-tolyl-buttersaeure |
| 3-methyl-3-p-tolyl-butyric acid |
| HMS1728A04 |
| 3-Methyl-3-p-tolylbutanoic acid |
