Introduction：Basic information about CAS 954-16-5|Mesityl(phenyl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mesityl(phenyl)methanone |
|---|
| CAS Number | 954-16-5 | Molecular Weight | 224.298 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 315.0±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H16O | Melting Point | 35 - 36ºC |
|---|
| MSDS | / | Flash Point | 131.2±14.2 °C |
|---|
Names
| Name | phenyl-(2,4,6-trimethylphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 315.0±11.0 °C at 760 mmHg |
|---|
| Melting Point | 35 - 36ºC |
|---|
| Molecular Formula | C16H16O |
|---|
| Molecular Weight | 224.298 |
|---|
| Flash Point | 131.2±14.2 °C |
|---|
| Exact Mass | 224.120117 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.56 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2)c(C)c1 |
|---|
Safety Information
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | 22-36-50/53 |
|---|
| Safety Phrases | 26-60-61 |
|---|
Synonyms
| Mesityl phenyl ketone |
| MFCD02685558 |
| Ketone, mesityl phenyl |
| Mesitylene, 2-benzoyl- |
| EINECS 403-150-9 |
| 2,4,6-trimethyl-benzophenone |
| Benzoylmesitylene |
| Benzophenone, 2,4,6-trimethyl- |
| Mesitylphenylketon |
| phenyl mesityl ketone |
| Ketone,mesityl phenyl |
| Mesityl(phenyl)methanone |
| Methanone, phenyl(2,4,6-trimethylphenyl)- |
| Mesitylene,2-benzoyl |
| Benzophenone,2,4,6-trimethyl |
