Introduction:Basic information about CAS 35086-59-0|3,5-Diacetoxyacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Diacetoxyacetophenone |
|---|
| CAS Number | 35086-59-0 | Molecular Weight | 236.22100 |
|---|
| Density | 1.203 g/cm3 | Boiling Point | 165-168 °C (0.7501 mmHg) |
|---|
| Molecular Formula | C12H12O5 | Melting Point | 91-94 °C(lit.) |
|---|
| MSDS | / | Flash Point | 168.7ºC |
|---|
Names
| Name | (3-acetyl-5-acetyloxyphenyl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.203 g/cm3 |
|---|
| Boiling Point | 165-168 °C (0.7501 mmHg) |
|---|
| Melting Point | 91-94 °C(lit.) |
|---|
| Molecular Formula | C12H12O5 |
|---|
| Molecular Weight | 236.22100 |
|---|
| Flash Point | 168.7ºC |
|---|
| Exact Mass | 236.06800 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.73980 |
|---|
| Index of Refraction | 1.512 |
|---|
| InChIKey | QODJHYBESCIPOG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(C)=O)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00008702 |
| 3',5'-Diacetoxyacetophenone |
| 1-(3',5'-diacetoxyphenyl)ethanone |
| EINECS 252-354-2 |
| 1-(3,5-Diacetoxy-phenyl)-aethanon |
| 3,5-Diacetoxyacetophenone |
| 5-acetyl-1,3-phenylene diacetate |
| 3-acetyl-5-acetyloxyphenyl acetate |